emilysiegel3190 emilysiegel3190

12-08-2018
Arts

contestada

What is the name of the system invented by Arnold Schoenberg where each note of the scale is given equal importance?

Respuesta :

12-08-2018

Twelve-tone technique—also known as dodecaphony, twelve-tone serialism

Answer Link

Tanahill80 Tanahill80

11-09-2019

Answer:

Explanation:

The twelve-tone system

Answer Link

Otras preguntas

2x+3y=-7Help me write Slope-Intercept form

Anions are those elements on the upper right side of the periodic table, excluding the Noble gases, that gain electrons when they ionize. T or F?

There is a line that includes the point (-14,-5) and has a slope of 0. What is its equation in slope-intercept form?

1)By using the following word equations, complete the table bydeciding which are the reactants and which are the products,Sulphuric acid + Zinc - Zinc sulphate.

Which of the following is a comment you might make about the "aesthetics" of a painting? A. the painting was created using unusual tools. B. the painting has a

Choose one property of water that makes it unique describe the property and explain the chemical or physical reasons that causes water to have to property.

cosec(6b+pi/8)=sec(2b-pi/8)

Graph f(x)=[tex]2^{x}[/tex]−1 and g(x)=−x+5 on the same coordinate plane. What is the solution to the equation f(x)=g(x) ? X=?

A 6-pound bag of chocolate candies costs $14.04. What is the unit price?

A television rating services found that out of a sample of 104 households, 33 were watching Town Talk during its time slot. Suppose there are 188,000 households