onlycheesy onlycheesy
  • 14-02-2019
  • Geography
contestada

True or false:lava cools so quickly that there are never any visible grains in it

Respuesta :

liherrera liherrera
  • 15-02-2019

i THINK it's false

online it explains "Because extrusive rocks make contact with the atmosphere they cool quickly, so the minerals do not have time to form large crystals. The individual crystals in an aphanitic igneous rock are not distinguishable to the naked eye"

Answer Link
masontroy1 masontroy1
  • 23-02-2019

It is False

Hope this helps

Answer Link

Otras preguntas

Indentify three contributions the Greeks provided for ocean exploration.
g(x) = 3x3 - 28x2 + 29x + 140; x + 7​
use the remainder theorem to find the value of F(x). 2. Find F(-2). F(x)=4x^3-2x^2+3x-2
2. In the following reaction, identify the precipitate, write down the ionic, net ionic reactions. Name the spectator ions 2KCl(aq) + Pb(NO3) 2(aq) — 2KNO3(aq)
The length of a square is 256m and the breadth is 238m what is the perimeter
Why did Nativism increase during the early 19th century? A: The population of Irish and German immigrants rapidly grew. B: Catholics wanted the Pope to interven
What is the beer and wine revenue act
Although carefully monitored, the toddler still managed to defoliate the plant. * O compound O complex O simple O compound-complex
cosec(6b+pi/8)=sec(2b-pi/8)​
Photosynthesis is the process where plants use___ from the sun to convert water and carbon dioxide into glucose and starches with oxygen as a waste product