jtkgotosleep123
jtkgotosleep123 jtkgotosleep123
  • 01-12-2020
  • Mathematics
contestada

what is the exact value of cos(11pi/21)cos(pi/7)-sin(11pi/21)sin(pi/7)?

a. -squr3/2
b. -1/2
c. 1/2
d. squr3/2​

Respuesta :

funnymunchies2004
funnymunchies2004 funnymunchies2004
  • 07-12-2020

Answer:

B

Step-by-step explanation:

-1/2

Answer Link
camjjwo camjjwo
  • 12-06-2021

Answer:

B -1/2

Step-by-step explanation:

Answer Link

Otras preguntas

what is the sum of 6 7/8 + 4 5/8
What long-term effect do you think EU membership will have on nationalism in Europe? Explain.
The number 6 is halfway between 4.5 and 7.5.Answer the missing numbers below.The number 6 is halfway between 2.8 and .......The number 6 is halfway between -12
What are three interesting facts about Susan B. Anthony's childhood ?
If the function h(x) represents the number of full hours that it takes a person to assemble x sets of tires in a factory, which would be an appropriate domain f
Factor completely, the expression: 2x^3-2x^2-12x
Factor completely, the expression: 2x^3-2x^2-12x
a piece of wood is 180cm long, Tom cuts it into three pieces in the ratio 2:3:4 Work out the length of the longest piece
What are enzymes also known as? What do enzymes do to biological reactions? What do we call the special shape on an enzyme molecule? What are enzymes made of? W
what is the answer to this question -√(12)+5√(75)