uzirocky
uzirocky uzirocky
  • 02-03-2021
  • History
contestada

can someone tell me the answers pls i’m really far behind i’ll give brainlist and points

can someone tell me the answers pls im really far behind ill give brainlist and points class=

Respuesta :

sarahporter64
sarahporter64 sarahporter64
  • 02-03-2021

Answer:

1) F

2) T

3) T

4) T

5) T

6) T

7) I'm pretty sure its F

8) T

9) T

10) I think T

Explanation:

I hope this helps,  I haven't learned this stuff in forever lol

Answer Link

Otras preguntas

It's urgent can someone please help me!!
Combine any like terms in the expression. If there are no like terms, rewrite the expression. 5u+5u+u
How common is abuse in a relationship?
In order to estimate the percentage of campers at her camp that bring their lunch, Lori randomly surveys 85 of the 300 campers at her camp. She then calculates
a sum of money is divided in the ratio 3:5:9. Calculate the smallest share given that the largest share is $109
Show that cos(A+45)=cos45(cosA-sinA)
simplify 2 (d-9) -(3d-7)
Choose the types of scales most common in Western classical music. major scale tonic dominant minor scale
Is it possible to add chemical formulas .
Animals in the higher trophic levels generally share two characteristics. They are typically a) larger in size and fewer in number b) larger in size and more in