zbranch9179 zbranch9179

02-08-2022
Mathematics

contestada

20 is 50% of what number? If necessary, round to the nearest tenth.

Respuesta :

howeirdbeefy howeirdbeefy

02-08-2022

Answer:

40

Step-by-step explanation:

20 divided by 50% is 40

Brainliest?

Answer Link

StudentNotFound404 StudentNotFound404

02-08-2022

Answer:

20 is 50% of 40.

Step-by-step explanation:

1% = 1/100

50% = 50/100 or 1/2

1/2 = 20/n

1*20/2*20 = 20/n

20/40 = 20/n

n = 40

Answer Link

Otras preguntas

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

Why is international collaboration important when there are natural disasters?

Metabolic syndrome is a cluster of risk factors that appear to promote type 2 diabetes and _____.

Why did labor unions strongly oppose the north american free trade (nafta) agreement of 1993?

In a chemical reaction mass is converted what is it mean

Find the amount in a continuously compounded account for the following condition. Principal, $3000; Annual interest rate, 5.4%; time, 5 years

Luis solved this addition problem. 895 + 35 = 930 Which expression could Luis use to check his work?

Read each sentence and decide whether it describes type 1 diabetes, type 2 diabetes, or both. drag the terms on the left to the appropriate blanks on the right

To distinguish the trapezius fibers from the splenius capitis fibers, you could ask your partner to perform what movement of the head and neck?

Observing the temporal bone and locates the jugular foramen and the jugular fossa. what two types of bone markings has she identified?