bianca0205
bianca0205 bianca0205
  • 14-04-2017
  • Mathematics
contestada

What is DE????PLEASE HELP!!!!

What is DEPLEASE HELP class=

Respuesta :

Аноним Аноним
  • 14-04-2017
sin 44/20 = sin 61/×
x = 20 sin 61/sin 44
x = 25.18 in
Answer Link

Otras preguntas

log14/3 +log11/5-log22/15=log
What Are Fractions? In your own words, explain what a fraction is. Then give an example of an improper fraction and explain why this fraction is improper?
NO LINKS!!! Complete the tables of ratios for similar polygons​
Find the modulus and the unit vector along the sum of the vectors. - r₁ +r₂ +r3 given that r₁ = 2i+j+4k - r₂ = 3i-2j+7k, r3 = 5i + 2j - 3k. 2​
What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2
Find the value of the length x rounded to 1 DP.
how important do you think individuality is to americans today? try to think of two specific examples of how americans express individualism today in a social,
What is this quote about?
10/3 * 3^x -3^(x-1) = 81Solve for x.​
Compute the value of 1-2+3-4+5…+2019-2020+2021. Thanks